About 6-methoxy-2,5-dimethyl-1,3-dioxin-4-one
6-methoxy-2,5-dimethyl-1,3-dioxin-4-one (PubChem CID 138720071) has the molecular formula C7H10O4
and a molecular weight of 158.15 g/mol. Its IUPAC name is 6-methoxy-2,5-dimethyl-1,3-dioxin-4-one.
Molecular Properties
| Compound Name | 6-methoxy-2,5-dimethyl-1,3-dioxin-4-one |
| PubChem CID | 138720071 |
| Molecular Formula | C7H10O4 |
| Molecular Weight | 158.15 g/mol |
| Exact Mass | 158.06 |
| IUPAC Name | 6-methoxy-2,5-dimethyl-1,3-dioxin-4-one |
| SMILES | COC1=C(C)C(=O)OC(C)O1 |
| InChI | InChI=1S/C7H10O4/c1-4-6(8)10-5(2)11-7(4)9-3/h5H,1-3H3 |
| InChIKey | MLTCZXIATYLABT-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.15 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-methoxy-2,5-dimethyl-1,3-dioxin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methoxy-2,5-dimethyl-1,3-dioxin-4-one?
The IUPAC name of 6-methoxy-2,5-dimethyl-1,3-dioxin-4-one (CID 138720071) is 6-methoxy-2,5-dimethyl-1,3-dioxin-4-one.
What is the SMILES notation for 6-methoxy-2,5-dimethyl-1,3-dioxin-4-one?
The canonical SMILES for 6-methoxy-2,5-dimethyl-1,3-dioxin-4-one is COC1=C(C)C(=O)OC(C)O1.
What is the InChIKey of 6-methoxy-2,5-dimethyl-1,3-dioxin-4-one?
The InChIKey is MLTCZXIATYLABT-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10O4/c1-4-6(8)10-5(2)11-7(4)9-3/h5H,1-3H3.
What are the key properties of 6-methoxy-2,5-dimethyl-1,3-dioxin-4-one?
6-methoxy-2,5-dimethyl-1,3-dioxin-4-one has a molecular weight of 158.15 g/mol, XLogP of 0.78, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methoxy-2,5-dimethyl-1,3-dioxin-4-one is sourced from PubChem (CID 138720071), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).