About 2-(fluoromethyl)-1,4-dimethylpiperazine
2-(fluoromethyl)-1,4-dimethylpiperazine (PubChem CID 138720234) has the molecular formula C7H15FN2
and a molecular weight of 146.21 g/mol. Its IUPAC name is 2-(fluoromethyl)-1,4-dimethylpiperazine.
Molecular Properties
| Compound Name | 2-(fluoromethyl)-1,4-dimethylpiperazine |
| PubChem CID | 138720234 |
| Molecular Formula | C7H15FN2 |
| Molecular Weight | 146.21 g/mol |
| Exact Mass | 146.12 |
| IUPAC Name | 2-(fluoromethyl)-1,4-dimethylpiperazine |
| SMILES | CN1CCN(C)C(CF)C1 |
| InChI | InChI=1S/C7H15FN2/c1-9-3-4-10(2)7(5-8)6-9/h7H,3-6H2,1-2H3 |
| InChIKey | YZGFUFKLVTVTAN-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.21 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(fluoromethyl)-1,4-dimethylpiperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(fluoromethyl)-1,4-dimethylpiperazine?
The IUPAC name of 2-(fluoromethyl)-1,4-dimethylpiperazine (CID 138720234) is 2-(fluoromethyl)-1,4-dimethylpiperazine.
What is the SMILES notation for 2-(fluoromethyl)-1,4-dimethylpiperazine?
The canonical SMILES for 2-(fluoromethyl)-1,4-dimethylpiperazine is CN1CCN(C)C(CF)C1.
What is the InChIKey of 2-(fluoromethyl)-1,4-dimethylpiperazine?
The InChIKey is YZGFUFKLVTVTAN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15FN2/c1-9-3-4-10(2)7(5-8)6-9/h7H,3-6H2,1-2H3.
What are the key properties of 2-(fluoromethyl)-1,4-dimethylpiperazine?
2-(fluoromethyl)-1,4-dimethylpiperazine has a molecular weight of 146.21 g/mol, XLogP of 0.20, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(fluoromethyl)-1,4-dimethylpiperazine is sourced from PubChem (CID 138720234), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).