C14H19NO2 — CID 138720487
(2E,4Z)-6-(azetidin-3-yl)-3-ethenyl-2-ethylidenehepta-4,6-dienoic acid (PubChem CID 138720487) has the molecular formula C14H19NO2 and a molecular weight of 233.31 g/mol. Its IUPAC name is (2E,4Z)-6-(azetidin-3-yl)-3-ethenyl-2-ethylidenehepta-4,6-dienoic acid.
| Compound Name | (2E,4Z)-6-(azetidin-3-yl)-3-ethenyl-2-ethylidenehepta-4,6-dienoic acid |
|---|---|
| PubChem CID | 138720487 |
| Molecular Formula | C14H19NO2 |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.14 |
| IUPAC Name | (2E,4Z)-6-(azetidin-3-yl)-3-ethenyl-2-ethylidenehepta-4,6-dienoic acid |
| SMILES | C=CC(/C=C\C(=C)C1CNC1)/C(=C\C)C(=O)O |
| InChI | InChI=1S/C14H19NO2/c1-4-11(13(5-2)14(16)17)7-6-10(3)12-8-15-9-12/h4-7,11-12,15H,1,3,8-9H2,2H3,(H,16,17)/b7-6-,13-5+ |
| InChIKey | JMANJHGOMIJJAA-ZQNRWWJISA-N |
| XLogP | 2.15 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|