C23H28FN3O6S — CID 138720499
(2,5-dioxopyrrolidin-1-yl) 4-[[(5E)-4-fluoro-5-[(3-methyl-3-sulfanylbutanoyl)hydrazinylidene]-7,8-dihydro-6H-naphthalen-2-yl]oxy]butanoate (PubChem CID 138720499) has the molecular formula C23H28FN3O6S and a molecular weight of 493.56 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 4-[[(5E)-4-fluoro-5-[(3-methyl-3-sulfanylbutanoyl)hydrazinylidene]-7,8-dihydro-6H-naphthalen-2-yl]oxy]butanoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 4-[[(5E)-4-fluoro-5-[(3-methyl-3-sulfanylbutanoyl)hydrazinylidene]-7,8-dihydro-6H-naphthalen-2-yl]oxy]butanoate |
|---|---|
| PubChem CID | 138720499 |
| Molecular Formula | C23H28FN3O6S |
| Molecular Weight | 493.56 g/mol |
| Exact Mass | 493.17 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 4-[[(5E)-4-fluoro-5-[(3-methyl-3-sulfanylbutanoyl)hydrazinylidene]-7,8-dihydro-6H-naphthalen-2-yl]oxy]butanoate |
| SMILES | CC(C)(S)CC(=O)N/N=C1\CCCc2cc(OCCCC(=O)ON3C(=O)CCC3=O)cc(F)c21 |
| InChI | InChI=1S/C23H28FN3O6S/c1-23(2,34)13-18(28)26-25-17-6-3-5-14-11-15(12-16(24)22(14)17)32-10-4-7-21(31)33-27-19(29)8-9-20(27)30/h11-12,34H,3-10,13H2,1-2H3,(H,26,28)/b25-17+ |
| InChIKey | DBMBXRHVPONHPZ-KOEQRZSOSA-N |
| XLogP | 2.85 |
| TPSA | 114.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.56 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|