C28H31F4N5O4S — CID 138720527
2-[(4S)-7-fluoro-2-[(3R)-4-(5-methoxy-3-pyridinyl)-3-methylpiperazin-1-yl]-3-[(2E,4E)-1-methoxy-4-(trifluoromethyl)hepta-2,4,6-trien-2-yl]-4H-thieno[3,4-d]pyrimidin-4-yl]acetic acid (PubChem CID 138720527) has the molecular formula C28H31F4N5O4S and a molecular weight of 609.65 g/mol. Its IUPAC name is 2-[(4S)-7-fluoro-2-[(3R)-4-(5-methoxy-3-pyridinyl)-3-methylpiperazin-1-yl]-3-[(2E,4E)-1-methoxy-4-(trifluoromethyl)hepta-2,4,6-trien-2-yl]-4H-thieno[3,4-d]pyrimidin-4-yl]acetic acid.
| Compound Name | 2-[(4S)-7-fluoro-2-[(3R)-4-(5-methoxy-3-pyridinyl)-3-methylpiperazin-1-yl]-3-[(2E,4E)-1-methoxy-4-(trifluoromethyl)hepta-2,4,6-trien-2-yl]-4H-thieno[3,4-d]pyrimidin-4-yl]acetic acid |
|---|---|
| PubChem CID | 138720527 |
| Molecular Formula | C28H31F4N5O4S |
| Molecular Weight | 609.65 g/mol |
| Exact Mass | 609.20 |
| IUPAC Name | 2-[(4S)-7-fluoro-2-[(3R)-4-(5-methoxy-3-pyridinyl)-3-methylpiperazin-1-yl]-3-[(2E,4E)-1-methoxy-4-(trifluoromethyl)hepta-2,4,6-trien-2-yl]-4H-thieno[3,4-d]pyrimidin-4-yl]acetic acid |
| SMILES | C=C/C=C(\C=C(/COC)N1C(N2CCN(c3cncc(OC)c3)[C@H](C)C2)=Nc2c(csc2F)[C@@H]1CC(=O)O)C(F)(F)F |
| InChI | InChI=1S/C28H31F4N5O4S/c1-5-6-18(28(30,31)32)9-20(15-40-3)37-23(11-24(38)39)22-16-42-26(29)25(22)34-27(37)35-7-8-36(17(2)14-35)19-10-21(41-4)13-33-12-19/h5-6,9-10,12-13,16-17,23H,1,7-8,11,14-15H2,2-4H3,(H,38,39)/b18-6+,20-9+/t17-,23+/m1/s1 |
| InChIKey | KYQUHTXISGGNGB-GSSWYWCXSA-N |
| XLogP | 5.53 |
| TPSA | 90.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.65 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|