About 7-methyl-7-propan-2-yl-[1,2,4]triazolo[1,5-a]azepine
7-methyl-7-propan-2-yl-[1,2,4]triazolo[1,5-a]azepine (PubChem CID 138721191) has the molecular formula C11H15N3
and a molecular weight of 189.26 g/mol. Its IUPAC name is 7-methyl-7-propan-2-yl-[1,2,4]triazolo[1,5-a]azepine.
Molecular Properties
| Compound Name | 7-methyl-7-propan-2-yl-[1,2,4]triazolo[1,5-a]azepine |
| PubChem CID | 138721191 |
| Molecular Formula | C11H15N3 |
| Molecular Weight | 189.26 g/mol |
| Exact Mass | 189.13 |
| IUPAC Name | 7-methyl-7-propan-2-yl-[1,2,4]triazolo[1,5-a]azepine |
| SMILES | CC(C)C1(C)C=Cc2ncnn2C=C1 |
| InChI | InChI=1S/C11H15N3/c1-9(2)11(3)5-4-10-12-8-13-14(10)7-6-11/h4-9H,1-3H3 |
| InChIKey | YDUBPKFJJWORLT-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.26 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7-methyl-7-propan-2-yl-[1,2,4]triazolo[1,5-a]azepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methyl-7-propan-2-yl-[1,2,4]triazolo[1,5-a]azepine?
The IUPAC name of 7-methyl-7-propan-2-yl-[1,2,4]triazolo[1,5-a]azepine (CID 138721191) is 7-methyl-7-propan-2-yl-[1,2,4]triazolo[1,5-a]azepine.
What is the SMILES notation for 7-methyl-7-propan-2-yl-[1,2,4]triazolo[1,5-a]azepine?
The canonical SMILES for 7-methyl-7-propan-2-yl-[1,2,4]triazolo[1,5-a]azepine is CC(C)C1(C)C=Cc2ncnn2C=C1.
What is the InChIKey of 7-methyl-7-propan-2-yl-[1,2,4]triazolo[1,5-a]azepine?
The InChIKey is YDUBPKFJJWORLT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15N3/c1-9(2)11(3)5-4-10-12-8-13-14(10)7-6-11/h4-9H,1-3H3.
What are the key properties of 7-methyl-7-propan-2-yl-[1,2,4]triazolo[1,5-a]azepine?
7-methyl-7-propan-2-yl-[1,2,4]triazolo[1,5-a]azepine has a molecular weight of 189.26 g/mol, XLogP of 2.44, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methyl-7-propan-2-yl-[1,2,4]triazolo[1,5-a]azepine is sourced from PubChem (CID 138721191), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).