C20H24O — CID 138721263
(2E,4Z)-1-(5-methyl-2-prop-1-en-2-ylphenyl)-4-propylhepta-2,4-dien-6-yn-2-ol (PubChem CID 138721263) has the molecular formula C20H24O and a molecular weight of 280.41 g/mol. Its IUPAC name is (2E,4Z)-1-(5-methyl-2-prop-1-en-2-ylphenyl)-4-propylhepta-2,4-dien-6-yn-2-ol.
| Compound Name | (2E,4Z)-1-(5-methyl-2-prop-1-en-2-ylphenyl)-4-propylhepta-2,4-dien-6-yn-2-ol |
|---|---|
| PubChem CID | 138721263 |
| Molecular Formula | C20H24O |
| Molecular Weight | 280.41 g/mol |
| Exact Mass | 280.18 |
| IUPAC Name | (2E,4Z)-1-(5-methyl-2-prop-1-en-2-ylphenyl)-4-propylhepta-2,4-dien-6-yn-2-ol |
| SMILES | C#C/C=C(\C=C(\O)Cc1cc(C)ccc1C(=C)C)CCC |
| InChI | InChI=1S/C20H24O/c1-6-8-17(9-7-2)13-19(21)14-18-12-16(5)10-11-20(18)15(3)4/h1,8,10-13,21H,3,7,9,14H2,2,4-5H3/b17-8-,19-13+ |
| InChIKey | NNXKVESYJCYWAL-SXRXVLNNSA-N |
| XLogP | 5.37 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.41 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|