C20H22BrClFN3O3 — CID 138721670
tert-butyl (4R,7R)-15-bromo-16-chloro-14-fluoro-4-methyl-9-oxa-2,5,12-triazatetracyclo[8.8.0.02,7.013,18]octadeca-1(10),11,13,15,17-pentaene-5-carboxylate (PubChem CID 138721670) has the molecular formula C20H22BrClFN3O3 and a molecular weight of 486.77 g/mol. Its IUPAC name is tert-butyl (4R,7R)-15-bromo-16-chloro-14-fluoro-4-methyl-9-oxa-2,5,12-triazatetracyclo[8.8.0.02,7.013,18]octadeca-1(10),11,13,15,17-pentaene-5-carboxylate.
| Compound Name | tert-butyl (4R,7R)-15-bromo-16-chloro-14-fluoro-4-methyl-9-oxa-2,5,12-triazatetracyclo[8.8.0.02,7.013,18]octadeca-1(10),11,13,15,17-pentaene-5-carboxylate |
|---|---|
| PubChem CID | 138721670 |
| Molecular Formula | C20H22BrClFN3O3 |
| Molecular Weight | 486.77 g/mol |
| Exact Mass | 485.05 |
| IUPAC Name | tert-butyl (4R,7R)-15-bromo-16-chloro-14-fluoro-4-methyl-9-oxa-2,5,12-triazatetracyclo[8.8.0.02,7.013,18]octadeca-1(10),11,13,15,17-pentaene-5-carboxylate |
| SMILES | C[C@@H]1CN2c3c(cnc4c(F)c(Br)c(Cl)cc34)OC[C@H]2CN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H22BrClFN3O3/c1-10-7-26-11(8-25(10)19(27)29-20(2,3)4)9-28-14-6-24-17-12(18(14)26)5-13(22)15(21)16(17)23/h5-6,10-11H,7-9H2,1-4H3/t10-,11-/m1/s1 |
| InChIKey | RFGOQRULIGDMMY-GHMZBOCLSA-N |
| XLogP | 5.00 |
| TPSA | 54.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.77 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|