C19H20BrClFN3O3 — CID 138721690
tert-butyl (7R)-15-bromo-16-chloro-14-fluoro-9-oxa-2,5,12-triazatetracyclo[8.8.0.02,7.013,18]octadeca-1(10),11,13,15,17-pentaene-5-carboxylate (PubChem CID 138721690) has the molecular formula C19H20BrClFN3O3 and a molecular weight of 472.74 g/mol. Its IUPAC name is tert-butyl (7R)-15-bromo-16-chloro-14-fluoro-9-oxa-2,5,12-triazatetracyclo[8.8.0.02,7.013,18]octadeca-1(10),11,13,15,17-pentaene-5-carboxylate.
| Compound Name | tert-butyl (7R)-15-bromo-16-chloro-14-fluoro-9-oxa-2,5,12-triazatetracyclo[8.8.0.02,7.013,18]octadeca-1(10),11,13,15,17-pentaene-5-carboxylate |
|---|---|
| PubChem CID | 138721690 |
| Molecular Formula | C19H20BrClFN3O3 |
| Molecular Weight | 472.74 g/mol |
| Exact Mass | 471.04 |
| IUPAC Name | tert-butyl (7R)-15-bromo-16-chloro-14-fluoro-9-oxa-2,5,12-triazatetracyclo[8.8.0.02,7.013,18]octadeca-1(10),11,13,15,17-pentaene-5-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN2c3c(cnc4c(F)c(Br)c(Cl)cc34)OC[C@H]2C1 |
| InChI | InChI=1S/C19H20BrClFN3O3/c1-19(2,3)28-18(26)24-4-5-25-10(8-24)9-27-13-7-23-16-11(17(13)25)6-12(21)14(20)15(16)22/h6-7,10H,4-5,8-9H2,1-3H3/t10-/m1/s1 |
| InChIKey | XHPPUTRALKCJCV-SNVBAGLBSA-N |
| XLogP | 4.61 |
| TPSA | 54.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.74 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|