C34H25N9 — CID 138721922
N-[(1E,3E)-2,4-bis[3,5-di(pyrimidin-5-yl)phenyl]penta-1,3-dienyl]methanimine (PubChem CID 138721922) has the molecular formula C34H25N9 and a molecular weight of 559.64 g/mol. Its IUPAC name is N-[(1E,3E)-2,4-bis[3,5-di(pyrimidin-5-yl)phenyl]penta-1,3-dienyl]methanimine.
| Compound Name | N-[(1E,3E)-2,4-bis[3,5-di(pyrimidin-5-yl)phenyl]penta-1,3-dienyl]methanimine |
|---|---|
| PubChem CID | 138721922 |
| Molecular Formula | C34H25N9 |
| Molecular Weight | 559.64 g/mol |
| Exact Mass | 559.22 |
| IUPAC Name | N-[(1E,3E)-2,4-bis[3,5-di(pyrimidin-5-yl)phenyl]penta-1,3-dienyl]methanimine |
| SMILES | C=N/C=C(\C=C(/C)c1cc(-c2cncnc2)cc(-c2cncnc2)c1)c1cc(-c2cncnc2)cc(-c2cncnc2)c1 |
| InChI | InChI=1S/C34H25N9/c1-23(24-4-26(31-11-36-19-37-12-31)8-27(5-24)32-13-38-20-39-14-32)3-30(10-35-2)25-6-28(33-15-40-21-41-16-33)9-29(7-25)34-17-42-22-43-18-34/h3-22H,2H2,1H3/b23-3+,30-10+ |
| InChIKey | FPOLRUJCJCJJRG-QCHALDKOSA-N |
| XLogP | 6.66 |
| TPSA | 115.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.64 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|