C21H30FN5O5S — CID 138722318
tert-butyl N-[4a-(2-fluorophenyl)-7-methoxy-2-methyl-1,1-dioxo-6,7,8,8a-tetrahydro-5H-1λ6,2,4-benzothiadiazin-3-yl]-N-(2-methylidenehydrazinyl)carbamate (PubChem CID 138722318) has the molecular formula C21H30FN5O5S and a molecular weight of 483.57 g/mol. Its IUPAC name is tert-butyl N-[4a-(2-fluorophenyl)-7-methoxy-2-methyl-1,1-dioxo-6,7,8,8a-tetrahydro-5H-1λ6,2,4-benzothiadiazin-3-yl]-N-(2-methylidenehydrazinyl)carbamate.
| Compound Name | tert-butyl N-[4a-(2-fluorophenyl)-7-methoxy-2-methyl-1,1-dioxo-6,7,8,8a-tetrahydro-5H-1λ6,2,4-benzothiadiazin-3-yl]-N-(2-methylidenehydrazinyl)carbamate |
|---|---|
| PubChem CID | 138722318 |
| Molecular Formula | C21H30FN5O5S |
| Molecular Weight | 483.57 g/mol |
| Exact Mass | 483.20 |
| IUPAC Name | tert-butyl N-[4a-(2-fluorophenyl)-7-methoxy-2-methyl-1,1-dioxo-6,7,8,8a-tetrahydro-5H-1λ6,2,4-benzothiadiazin-3-yl]-N-(2-methylidenehydrazinyl)carbamate |
| SMILES | C=NNN(C(=O)OC(C)(C)C)C1=NC2(c3ccccc3F)CCC(OC)CC2S(=O)(=O)N1C |
| InChI | InChI=1S/C21H30FN5O5S/c1-20(2,3)32-19(28)27(25-23-4)18-24-21(15-9-7-8-10-16(15)22)12-11-14(31-6)13-17(21)33(29,30)26(18)5/h7-10,14,17,25H,4,11-13H2,1-3,5-6H3 |
| InChIKey | FQOVLNHBUYMDOW-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 112.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.57 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|