C14H18FN3O3S — CID 138722674
3-[(4aR,7aR)-3-amino-2,7a-dimethyl-1,1-dioxo-6,7-dihydro-5H-cyclopenta[e][1,2,4]thiadiazin-4a-yl]-4-fluorophenol (PubChem CID 138722674) has the molecular formula C14H18FN3O3S and a molecular weight of 327.38 g/mol. Its IUPAC name is 3-[(4aR,7aR)-3-amino-2,7a-dimethyl-1,1-dioxo-6,7-dihydro-5H-cyclopenta[e][1,2,4]thiadiazin-4a-yl]-4-fluorophenol.
| Compound Name | 3-[(4aR,7aR)-3-amino-2,7a-dimethyl-1,1-dioxo-6,7-dihydro-5H-cyclopenta[e][1,2,4]thiadiazin-4a-yl]-4-fluorophenol |
|---|---|
| PubChem CID | 138722674 |
| Molecular Formula | C14H18FN3O3S |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.11 |
| IUPAC Name | 3-[(4aR,7aR)-3-amino-2,7a-dimethyl-1,1-dioxo-6,7-dihydro-5H-cyclopenta[e][1,2,4]thiadiazin-4a-yl]-4-fluorophenol |
| SMILES | CN1C(N)=N[C@@]2(c3cc(O)ccc3F)CCC[C@@]2(C)S1(=O)=O |
| InChI | InChI=1S/C14H18FN3O3S/c1-13-6-3-7-14(13,10-8-9(19)4-5-11(10)15)17-12(16)18(2)22(13,20)21/h4-5,8,19H,3,6-7H2,1-2H3,(H2,16,17)/t13-,14-/m1/s1 |
| InChIKey | WIILKULELHRBBE-ZIAGYGMSSA-N |
| XLogP | 1.26 |
| TPSA | 95.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |