C14H10F12O2 — CID 138722722
2-[5-ethenyl-3-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)cyclohexa-1,3-dien-1-yl]-1,1,1,3,3,3-hexafluoropropan-2-ol (PubChem CID 138722722) has the molecular formula C14H10F12O2 and a molecular weight of 438.21 g/mol. Its IUPAC name is 2-[5-ethenyl-3-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)cyclohexa-1,3-dien-1-yl]-1,1,1,3,3,3-hexafluoropropan-2-ol.
| Compound Name | 2-[5-ethenyl-3-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)cyclohexa-1,3-dien-1-yl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
|---|---|
| PubChem CID | 138722722 |
| Molecular Formula | C14H10F12O2 |
| Molecular Weight | 438.21 g/mol |
| Exact Mass | 438.05 |
| IUPAC Name | 2-[5-ethenyl-3-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)cyclohexa-1,3-dien-1-yl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
| SMILES | C=CC1C=C(C(O)(C(F)(F)F)C(F)(F)F)C=C(C(O)(C(F)(F)F)C(F)(F)F)C1 |
| InChI | InChI=1S/C14H10F12O2/c1-2-6-3-7(9(27,11(15,16)17)12(18,19)20)5-8(4-6)10(28,13(21,22)23)14(24,25)26/h2-3,5-6,27-28H,1,4H2 |
| InChIKey | ZVGMFFFVCHSPGK-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.21 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|