C21H33N5 — CID 138722879
N'-[2-(methylideneamino)-3-[(Z)-prop-1-enyl]cyclohex-2-en-1-yl]-N'-[(1-prop-2-enylimidazol-2-yl)methyl]butane-1,4-diamine (PubChem CID 138722879) has the molecular formula C21H33N5 and a molecular weight of 355.53 g/mol. Its IUPAC name is N'-[2-(methylideneamino)-3-[(Z)-prop-1-enyl]cyclohex-2-en-1-yl]-N'-[(1-prop-2-enylimidazol-2-yl)methyl]butane-1,4-diamine.
| Compound Name | N'-[2-(methylideneamino)-3-[(Z)-prop-1-enyl]cyclohex-2-en-1-yl]-N'-[(1-prop-2-enylimidazol-2-yl)methyl]butane-1,4-diamine |
|---|---|
| PubChem CID | 138722879 |
| Molecular Formula | C21H33N5 |
| Molecular Weight | 355.53 g/mol |
| Exact Mass | 355.27 |
| IUPAC Name | N'-[2-(methylideneamino)-3-[(Z)-prop-1-enyl]cyclohex-2-en-1-yl]-N'-[(1-prop-2-enylimidazol-2-yl)methyl]butane-1,4-diamine |
| SMILES | C=CCn1ccnc1CN(CCCCN)C1CCCC(/C=C\C)=C1N=C |
| InChI | InChI=1S/C21H33N5/c1-4-9-18-10-8-11-19(21(18)23-3)26(15-7-6-12-22)17-20-24-13-16-25(20)14-5-2/h4-5,9,13,16,19H,2-3,6-8,10-12,14-15,17,22H2,1H3/b9-4- |
| InChIKey | FLGBOQNLFZTESL-WTKPLQERSA-N |
| XLogP | 3.69 |
| TPSA | 59.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.53 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|