C21H35N5 — CID 138723019
N'-[2-(methylideneamino)-3-[(Z)-prop-1-enyl]cyclohex-2-en-1-yl]-N'-[(1-propylimidazol-2-yl)methyl]butane-1,4-diamine (PubChem CID 138723019) has the molecular formula C21H35N5 and a molecular weight of 357.55 g/mol. Its IUPAC name is N'-[2-(methylideneamino)-3-[(Z)-prop-1-enyl]cyclohex-2-en-1-yl]-N'-[(1-propylimidazol-2-yl)methyl]butane-1,4-diamine.
| Compound Name | N'-[2-(methylideneamino)-3-[(Z)-prop-1-enyl]cyclohex-2-en-1-yl]-N'-[(1-propylimidazol-2-yl)methyl]butane-1,4-diamine |
|---|---|
| PubChem CID | 138723019 |
| Molecular Formula | C21H35N5 |
| Molecular Weight | 357.55 g/mol |
| Exact Mass | 357.29 |
| IUPAC Name | N'-[2-(methylideneamino)-3-[(Z)-prop-1-enyl]cyclohex-2-en-1-yl]-N'-[(1-propylimidazol-2-yl)methyl]butane-1,4-diamine |
| SMILES | C=NC1=C(/C=C\C)CCCC1N(CCCCN)Cc1nccn1CCC |
| InChI | InChI=1S/C21H35N5/c1-4-9-18-10-8-11-19(21(18)23-3)26(15-7-6-12-22)17-20-24-13-16-25(20)14-5-2/h4,9,13,16,19H,3,5-8,10-12,14-15,17,22H2,1-2H3/b9-4- |
| InChIKey | AZSJRMFGXXIEJF-WTKPLQERSA-N |
| XLogP | 3.92 |
| TPSA | 59.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.55 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|