About (2E,5Z)-3-ethylsulfanyl-1-methoxyhepta-2,5-diene
(2E,5Z)-3-ethylsulfanyl-1-methoxyhepta-2,5-diene (PubChem CID 138723480) has the molecular formula C10H18OS
and a molecular weight of 186.32 g/mol. Its IUPAC name is (2E,5Z)-3-ethylsulfanyl-1-methoxyhepta-2,5-diene.
Molecular Properties
| Compound Name | (2E,5Z)-3-ethylsulfanyl-1-methoxyhepta-2,5-diene |
| PubChem CID | 138723480 |
| Molecular Formula | C10H18OS |
| Molecular Weight | 186.32 g/mol |
| Exact Mass | 186.11 |
| IUPAC Name | (2E,5Z)-3-ethylsulfanyl-1-methoxyhepta-2,5-diene |
| SMILES | C/C=C\C/C(=C\COC)SCC |
| InChI | InChI=1S/C10H18OS/c1-4-6-7-10(12-5-2)8-9-11-3/h4,6,8H,5,7,9H2,1-3H3/b6-4-,10-8+ |
| InChIKey | FSMHDOYBUJQCNC-YUFRWXHNSA-N |
| XLogP | 3.24 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.32 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2E,5Z)-3-ethylsulfanyl-1-methoxyhepta-2,5-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E,5Z)-3-ethylsulfanyl-1-methoxyhepta-2,5-diene?
The IUPAC name of (2E,5Z)-3-ethylsulfanyl-1-methoxyhepta-2,5-diene (CID 138723480) is (2E,5Z)-3-ethylsulfanyl-1-methoxyhepta-2,5-diene.
What is the SMILES notation for (2E,5Z)-3-ethylsulfanyl-1-methoxyhepta-2,5-diene?
The canonical SMILES for (2E,5Z)-3-ethylsulfanyl-1-methoxyhepta-2,5-diene is C/C=C\C/C(=C\COC)SCC.
What is the InChIKey of (2E,5Z)-3-ethylsulfanyl-1-methoxyhepta-2,5-diene?
The InChIKey is FSMHDOYBUJQCNC-YUFRWXHNSA-N. The full InChI is InChI=1S/C10H18OS/c1-4-6-7-10(12-5-2)8-9-11-3/h4,6,8H,5,7,9H2,1-3H3/b6-4-,10-8+.
What are the key properties of (2E,5Z)-3-ethylsulfanyl-1-methoxyhepta-2,5-diene?
(2E,5Z)-3-ethylsulfanyl-1-methoxyhepta-2,5-diene has a molecular weight of 186.32 g/mol, XLogP of 3.24, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2E,5Z)-3-ethylsulfanyl-1-methoxyhepta-2,5-diene is sourced from PubChem (CID 138723480), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).