About (2E)-2-(cyclopropylmethylidene)-3-hydroxy-4,4-dimethylpentanenitrile
(2E)-2-(cyclopropylmethylidene)-3-hydroxy-4,4-dimethylpentanenitrile (PubChem CID 138723499) has the molecular formula C11H17NO
and a molecular weight of 179.26 g/mol. Its IUPAC name is (2E)-2-(cyclopropylmethylidene)-3-hydroxy-4,4-dimethylpentanenitrile.
Molecular Properties
| Compound Name | (2E)-2-(cyclopropylmethylidene)-3-hydroxy-4,4-dimethylpentanenitrile |
| PubChem CID | 138723499 |
| Molecular Formula | C11H17NO |
| Molecular Weight | 179.26 g/mol |
| Exact Mass | 179.13 |
| IUPAC Name | (2E)-2-(cyclopropylmethylidene)-3-hydroxy-4,4-dimethylpentanenitrile |
| SMILES | CC(C)(C)C(O)/C(C#N)=C/C1CC1 |
| InChI | InChI=1S/C11H17NO/c1-11(2,3)10(13)9(7-12)6-8-4-5-8/h6,8,10,13H,4-5H2,1-3H3/b9-6+ |
| InChIKey | FKTXHKJAZJNLBG-RMKNXTFCSA-N |
| XLogP | 2.25 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.26 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|
Analyze (2E)-2-(cyclopropylmethylidene)-3-hydroxy-4,4-dimethylpentanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E)-2-(cyclopropylmethylidene)-3-hydroxy-4,4-dimethylpentanenitrile?
The IUPAC name of (2E)-2-(cyclopropylmethylidene)-3-hydroxy-4,4-dimethylpentanenitrile (CID 138723499) is (2E)-2-(cyclopropylmethylidene)-3-hydroxy-4,4-dimethylpentanenitrile.
What is the SMILES notation for (2E)-2-(cyclopropylmethylidene)-3-hydroxy-4,4-dimethylpentanenitrile?
The canonical SMILES for (2E)-2-(cyclopropylmethylidene)-3-hydroxy-4,4-dimethylpentanenitrile is CC(C)(C)C(O)/C(C#N)=C/C1CC1.
What is the InChIKey of (2E)-2-(cyclopropylmethylidene)-3-hydroxy-4,4-dimethylpentanenitrile?
The InChIKey is FKTXHKJAZJNLBG-RMKNXTFCSA-N. The full InChI is InChI=1S/C11H17NO/c1-11(2,3)10(13)9(7-12)6-8-4-5-8/h6,8,10,13H,4-5H2,1-3H3/b9-6+.
What are the key properties of (2E)-2-(cyclopropylmethylidene)-3-hydroxy-4,4-dimethylpentanenitrile?
(2E)-2-(cyclopropylmethylidene)-3-hydroxy-4,4-dimethylpentanenitrile has a molecular weight of 179.26 g/mol, XLogP of 2.25, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2E)-2-(cyclopropylmethylidene)-3-hydroxy-4,4-dimethylpentanenitrile is sourced from PubChem (CID 138723499), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).