C20H30N2O2S — CID 138723578
3-[[(3E)-2-(cyclohexylmethyl)penta-1,3-dien-3-yl]amino]-N,4-dimethylbenzenesulfonamide (PubChem CID 138723578) has the molecular formula C20H30N2O2S and a molecular weight of 362.54 g/mol. Its IUPAC name is 3-[[(3E)-2-(cyclohexylmethyl)penta-1,3-dien-3-yl]amino]-N,4-dimethylbenzenesulfonamide.
| Compound Name | 3-[[(3E)-2-(cyclohexylmethyl)penta-1,3-dien-3-yl]amino]-N,4-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 138723578 |
| Molecular Formula | C20H30N2O2S |
| Molecular Weight | 362.54 g/mol |
| Exact Mass | 362.20 |
| IUPAC Name | 3-[[(3E)-2-(cyclohexylmethyl)penta-1,3-dien-3-yl]amino]-N,4-dimethylbenzenesulfonamide |
| SMILES | C=C(CC1CCCCC1)/C(=C\C)Nc1cc(S(=O)(=O)NC)ccc1C |
| InChI | InChI=1S/C20H30N2O2S/c1-5-19(16(3)13-17-9-7-6-8-10-17)22-20-14-18(12-11-15(20)2)25(23,24)21-4/h5,11-12,14,17,21-22H,3,6-10,13H2,1-2,4H3/b19-5+ |
| InChIKey | NHUYLUUUKPWYCZ-PTXOJBNSSA-N |
| XLogP | 4.75 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.54 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|