About N-methyl-1-[(4S)-2,2,4-trimethylpyrrolidin-1-yl]ethanimine
N-methyl-1-[(4S)-2,2,4-trimethylpyrrolidin-1-yl]ethanimine (PubChem CID 138723593) has the molecular formula C10H20N2
and a molecular weight of 168.28 g/mol. Its IUPAC name is N-methyl-1-[(4S)-2,2,4-trimethylpyrrolidin-1-yl]ethanimine.
Molecular Properties
| Compound Name | N-methyl-1-[(4S)-2,2,4-trimethylpyrrolidin-1-yl]ethanimine |
| PubChem CID | 138723593 |
| Molecular Formula | C10H20N2 |
| Molecular Weight | 168.28 g/mol |
| Exact Mass | 168.16 |
| IUPAC Name | N-methyl-1-[(4S)-2,2,4-trimethylpyrrolidin-1-yl]ethanimine |
| SMILES | C/N=C(\C)N1C[C@@H](C)CC1(C)C |
| InChI | InChI=1S/C10H20N2/c1-8-6-10(3,4)12(7-8)9(2)11-5/h8H,6-7H2,1-5H3/b11-9+/t8-/m0/s1 |
| InChIKey | JFGPLGVKMYKMJY-QMIUEANQSA-N |
| XLogP | 2.15 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.28 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N-methyl-1-[(4S)-2,2,4-trimethylpyrrolidin-1-yl]ethanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-1-[(4S)-2,2,4-trimethylpyrrolidin-1-yl]ethanimine?
The IUPAC name of N-methyl-1-[(4S)-2,2,4-trimethylpyrrolidin-1-yl]ethanimine (CID 138723593) is N-methyl-1-[(4S)-2,2,4-trimethylpyrrolidin-1-yl]ethanimine.
What is the SMILES notation for N-methyl-1-[(4S)-2,2,4-trimethylpyrrolidin-1-yl]ethanimine?
The canonical SMILES for N-methyl-1-[(4S)-2,2,4-trimethylpyrrolidin-1-yl]ethanimine is C/N=C(\C)N1C[C@@H](C)CC1(C)C.
What is the InChIKey of N-methyl-1-[(4S)-2,2,4-trimethylpyrrolidin-1-yl]ethanimine?
The InChIKey is JFGPLGVKMYKMJY-QMIUEANQSA-N. The full InChI is InChI=1S/C10H20N2/c1-8-6-10(3,4)12(7-8)9(2)11-5/h8H,6-7H2,1-5H3/b11-9+/t8-/m0/s1.
What are the key properties of N-methyl-1-[(4S)-2,2,4-trimethylpyrrolidin-1-yl]ethanimine?
N-methyl-1-[(4S)-2,2,4-trimethylpyrrolidin-1-yl]ethanimine has a molecular weight of 168.28 g/mol, XLogP of 2.15, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-1-[(4S)-2,2,4-trimethylpyrrolidin-1-yl]ethanimine is sourced from PubChem (CID 138723593), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).