About (1S)-4-(6-ethenoxyhexylsulfanyl)cyclohexa-2,4-dien-1-ol
(1S)-4-(6-ethenoxyhexylsulfanyl)cyclohexa-2,4-dien-1-ol (PubChem CID 138723742) has the molecular formula C14H22O2S
and a molecular weight of 254.39 g/mol. Its IUPAC name is (1S)-4-(6-ethenoxyhexylsulfanyl)cyclohexa-2,4-dien-1-ol.
Molecular Properties
| Compound Name | (1S)-4-(6-ethenoxyhexylsulfanyl)cyclohexa-2,4-dien-1-ol |
| PubChem CID | 138723742 |
| Molecular Formula | C14H22O2S |
| Molecular Weight | 254.39 g/mol |
| Exact Mass | 254.13 |
| IUPAC Name | (1S)-4-(6-ethenoxyhexylsulfanyl)cyclohexa-2,4-dien-1-ol |
| SMILES | C=COCCCCCCSC1=CC[C@H](O)C=C1 |
| InChI | InChI=1S/C14H22O2S/c1-2-16-11-5-3-4-6-12-17-14-9-7-13(15)8-10-14/h2,7,9-10,13,15H,1,3-6,8,11-12H2/t13-/m1/s1 |
| InChIKey | KDDXKNYNMPCOSF-CYBMUJFWSA-N |
| XLogP | 3.64 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.39 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (1S)-4-(6-ethenoxyhexylsulfanyl)cyclohexa-2,4-dien-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S)-4-(6-ethenoxyhexylsulfanyl)cyclohexa-2,4-dien-1-ol?
The IUPAC name of (1S)-4-(6-ethenoxyhexylsulfanyl)cyclohexa-2,4-dien-1-ol (CID 138723742) is (1S)-4-(6-ethenoxyhexylsulfanyl)cyclohexa-2,4-dien-1-ol.
What is the SMILES notation for (1S)-4-(6-ethenoxyhexylsulfanyl)cyclohexa-2,4-dien-1-ol?
The canonical SMILES for (1S)-4-(6-ethenoxyhexylsulfanyl)cyclohexa-2,4-dien-1-ol is C=COCCCCCCSC1=CC[C@H](O)C=C1.
What is the InChIKey of (1S)-4-(6-ethenoxyhexylsulfanyl)cyclohexa-2,4-dien-1-ol?
The InChIKey is KDDXKNYNMPCOSF-CYBMUJFWSA-N. The full InChI is InChI=1S/C14H22O2S/c1-2-16-11-5-3-4-6-12-17-14-9-7-13(15)8-10-14/h2,7,9-10,13,15H,1,3-6,8,11-12H2/t13-/m1/s1.
What are the key properties of (1S)-4-(6-ethenoxyhexylsulfanyl)cyclohexa-2,4-dien-1-ol?
(1S)-4-(6-ethenoxyhexylsulfanyl)cyclohexa-2,4-dien-1-ol has a molecular weight of 254.39 g/mol, XLogP of 3.64, 9 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1S)-4-(6-ethenoxyhexylsulfanyl)cyclohexa-2,4-dien-1-ol is sourced from PubChem (CID 138723742), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).