C33H63N7O3 — CID 138724105
N-[2-[bis[2-[(2,2,5,5-tetramethylpyrrolidine-3-carbonyl)amino]ethyl]amino]ethyl]-2,2,5,5-tetramethylpyrrolidine-3-carboxamide (PubChem CID 138724105) has the molecular formula C33H63N7O3 and a molecular weight of 605.91 g/mol. Its IUPAC name is N-[2-[bis[2-[(2,2,5,5-tetramethylpyrrolidine-3-carbonyl)amino]ethyl]amino]ethyl]-2,2,5,5-tetramethylpyrrolidine-3-carboxamide.
| Compound Name | N-[2-[bis[2-[(2,2,5,5-tetramethylpyrrolidine-3-carbonyl)amino]ethyl]amino]ethyl]-2,2,5,5-tetramethylpyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 138724105 |
| Molecular Formula | C33H63N7O3 |
| Molecular Weight | 605.91 g/mol |
| Exact Mass | 605.50 |
| IUPAC Name | N-[2-[bis[2-[(2,2,5,5-tetramethylpyrrolidine-3-carbonyl)amino]ethyl]amino]ethyl]-2,2,5,5-tetramethylpyrrolidine-3-carboxamide |
| SMILES | CC1(C)CC(C(=O)NCCN(CCNC(=O)C2CC(C)(C)NC2(C)C)CCNC(=O)C2CC(C)(C)NC2(C)C)C(C)(C)N1 |
| InChI | InChI=1S/C33H63N7O3/c1-28(2)19-22(31(7,8)37-28)25(41)34-13-16-40(17-14-35-26(42)23-20-29(3,4)38-32(23,9)10)18-15-36-27(43)24-21-30(5,6)39-33(24,11)12/h22-24,37-39H,13-21H2,1-12H3,(H,34,41)(H,35,42)(H,36,43) |
| InChIKey | BVDLTCAKIPVTQR-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 126.63 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.91 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |