C23H44N4O2 — CID 138724230
1,2,2,5,5-pentamethyl-N-[4-[(2,2,5,5-tetramethylpyrrolidine-3-carbonyl)amino]butyl]pyrrolidine-3-carboxamide (PubChem CID 138724230) has the molecular formula C23H44N4O2 and a molecular weight of 408.63 g/mol. Its IUPAC name is 1,2,2,5,5-pentamethyl-N-[4-[(2,2,5,5-tetramethylpyrrolidine-3-carbonyl)amino]butyl]pyrrolidine-3-carboxamide.
| Compound Name | 1,2,2,5,5-pentamethyl-N-[4-[(2,2,5,5-tetramethylpyrrolidine-3-carbonyl)amino]butyl]pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 138724230 |
| Molecular Formula | C23H44N4O2 |
| Molecular Weight | 408.63 g/mol |
| Exact Mass | 408.35 |
| IUPAC Name | 1,2,2,5,5-pentamethyl-N-[4-[(2,2,5,5-tetramethylpyrrolidine-3-carbonyl)amino]butyl]pyrrolidine-3-carboxamide |
| SMILES | CN1C(C)(C)CC(C(=O)NCCCCNC(=O)C2CC(C)(C)NC2(C)C)C1(C)C |
| InChI | InChI=1S/C23H44N4O2/c1-20(2)14-16(22(5,6)26-20)18(28)24-12-10-11-13-25-19(29)17-15-21(3,4)27(9)23(17,7)8/h16-17,26H,10-15H2,1-9H3,(H,24,28)(H,25,29) |
| InChIKey | YJEPYAHOKSCMJD-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.63 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|