C21H40N4O2 — CID 138724232
1,2,2,5,5-pentamethyl-N-[2-[(2,2,5,5-tetramethylpyrrolidine-3-carbonyl)amino]ethyl]pyrrolidine-3-carboxamide (PubChem CID 138724232) has the molecular formula C21H40N4O2 and a molecular weight of 380.58 g/mol. Its IUPAC name is 1,2,2,5,5-pentamethyl-N-[2-[(2,2,5,5-tetramethylpyrrolidine-3-carbonyl)amino]ethyl]pyrrolidine-3-carboxamide.
| Compound Name | 1,2,2,5,5-pentamethyl-N-[2-[(2,2,5,5-tetramethylpyrrolidine-3-carbonyl)amino]ethyl]pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 138724232 |
| Molecular Formula | C21H40N4O2 |
| Molecular Weight | 380.58 g/mol |
| Exact Mass | 380.32 |
| IUPAC Name | 1,2,2,5,5-pentamethyl-N-[2-[(2,2,5,5-tetramethylpyrrolidine-3-carbonyl)amino]ethyl]pyrrolidine-3-carboxamide |
| SMILES | CN1C(C)(C)CC(C(=O)NCCNC(=O)C2CC(C)(C)NC2(C)C)C1(C)C |
| InChI | InChI=1S/C21H40N4O2/c1-18(2)12-14(20(5,6)24-18)16(26)22-10-11-23-17(27)15-13-19(3,4)25(9)21(15,7)8/h14-15,24H,10-13H2,1-9H3,(H,22,26)(H,23,27) |
| InChIKey | FURZIEPNIMDBRK-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.58 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|