C25H48N4O2 — CID 138724233
1,2,2,5,5-pentamethyl-N-[6-[(2,2,5,5-tetramethylpyrrolidine-3-carbonyl)amino]hexyl]pyrrolidine-3-carboxamide (PubChem CID 138724233) has the molecular formula C25H48N4O2 and a molecular weight of 436.69 g/mol. Its IUPAC name is 1,2,2,5,5-pentamethyl-N-[6-[(2,2,5,5-tetramethylpyrrolidine-3-carbonyl)amino]hexyl]pyrrolidine-3-carboxamide.
| Compound Name | 1,2,2,5,5-pentamethyl-N-[6-[(2,2,5,5-tetramethylpyrrolidine-3-carbonyl)amino]hexyl]pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 138724233 |
| Molecular Formula | C25H48N4O2 |
| Molecular Weight | 436.69 g/mol |
| Exact Mass | 436.38 |
| IUPAC Name | 1,2,2,5,5-pentamethyl-N-[6-[(2,2,5,5-tetramethylpyrrolidine-3-carbonyl)amino]hexyl]pyrrolidine-3-carboxamide |
| SMILES | CN1C(C)(C)CC(C(=O)NCCCCCCNC(=O)C2CC(C)(C)NC2(C)C)C1(C)C |
| InChI | InChI=1S/C25H48N4O2/c1-22(2)16-18(24(5,6)28-22)20(30)26-14-12-10-11-13-15-27-21(31)19-17-23(3,4)29(9)25(19,7)8/h18-19,28H,10-17H2,1-9H3,(H,26,30)(H,27,31) |
| InChIKey | GUWYEQBBOSIWIX-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.69 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|