C27H52N4O2 — CID 138724234
1,2,2,5,5-pentamethyl-N-[8-[(2,2,5,5-tetramethylpyrrolidine-3-carbonyl)amino]octyl]pyrrolidine-3-carboxamide (PubChem CID 138724234) has the molecular formula C27H52N4O2 and a molecular weight of 464.74 g/mol. Its IUPAC name is 1,2,2,5,5-pentamethyl-N-[8-[(2,2,5,5-tetramethylpyrrolidine-3-carbonyl)amino]octyl]pyrrolidine-3-carboxamide.
| Compound Name | 1,2,2,5,5-pentamethyl-N-[8-[(2,2,5,5-tetramethylpyrrolidine-3-carbonyl)amino]octyl]pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 138724234 |
| Molecular Formula | C27H52N4O2 |
| Molecular Weight | 464.74 g/mol |
| Exact Mass | 464.41 |
| IUPAC Name | 1,2,2,5,5-pentamethyl-N-[8-[(2,2,5,5-tetramethylpyrrolidine-3-carbonyl)amino]octyl]pyrrolidine-3-carboxamide |
| SMILES | CN1C(C)(C)CC(C(=O)NCCCCCCCCNC(=O)C2CC(C)(C)NC2(C)C)C1(C)C |
| InChI | InChI=1S/C27H52N4O2/c1-24(2)18-20(26(5,6)30-24)22(32)28-16-14-12-10-11-13-15-17-29-23(33)21-19-25(3,4)31(9)27(21,7)8/h20-21,30H,10-19H2,1-9H3,(H,28,32)(H,29,33) |
| InChIKey | LOSPCWHLMZNABT-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.74 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|