C33H60N4O7 — CID 138724844
(2,2,5,5-tetramethylpyrrolidin-3-yl)methyl 2-[[2-[(1-hydroxy-2,2,5,5-tetramethylpyrrolidin-3-yl)methoxy]-2-oxoethyl]-[2-oxo-2-[(2,2,5,5-tetramethylpyrrolidin-3-yl)methoxy]ethyl]amino]acetate (PubChem CID 138724844) has the molecular formula C33H60N4O7 and a molecular weight of 624.86 g/mol. Its IUPAC name is (2,2,5,5-tetramethylpyrrolidin-3-yl)methyl 2-[[2-[(1-hydroxy-2,2,5,5-tetramethylpyrrolidin-3-yl)methoxy]-2-oxoethyl]-[2-oxo-2-[(2,2,5,5-tetramethylpyrrolidin-3-yl)methoxy]ethyl]amino]acetate.
| Compound Name | (2,2,5,5-tetramethylpyrrolidin-3-yl)methyl 2-[[2-[(1-hydroxy-2,2,5,5-tetramethylpyrrolidin-3-yl)methoxy]-2-oxoethyl]-[2-oxo-2-[(2,2,5,5-tetramethylpyrrolidin-3-yl)methoxy]ethyl]amino]acetate |
|---|---|
| PubChem CID | 138724844 |
| Molecular Formula | C33H60N4O7 |
| Molecular Weight | 624.86 g/mol |
| Exact Mass | 624.45 |
| IUPAC Name | (2,2,5,5-tetramethylpyrrolidin-3-yl)methyl 2-[[2-[(1-hydroxy-2,2,5,5-tetramethylpyrrolidin-3-yl)methoxy]-2-oxoethyl]-[2-oxo-2-[(2,2,5,5-tetramethylpyrrolidin-3-yl)methoxy]ethyl]amino]acetate |
| SMILES | CC1(C)CC(COC(=O)CN(CC(=O)OCC2CC(C)(C)NC2(C)C)CC(=O)OCC2CC(C)(C)N(O)C2(C)C)C(C)(C)N1 |
| InChI | InChI=1S/C33H60N4O7/c1-28(2)13-22(31(7,8)34-28)19-42-25(38)16-36(17-26(39)43-20-23-14-29(3,4)35-32(23,9)10)18-27(40)44-21-24-15-30(5,6)37(41)33(24,11)12/h22-24,34-35,41H,13-21H2,1-12H3 |
| InChIKey | ILSWEUKDAOZRJI-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 129.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.86 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|