About methyl 3-[5-methyl-3-(2-methylpropyl)cyclohexa-1,3-dien-1-yl]propanoate
methyl 3-[5-methyl-3-(2-methylpropyl)cyclohexa-1,3-dien-1-yl]propanoate (PubChem CID 138725199) has the molecular formula C15H24O2
and a molecular weight of 236.35 g/mol. Its IUPAC name is methyl 3-[5-methyl-3-(2-methylpropyl)cyclohexa-1,3-dien-1-yl]propanoate.
Molecular Properties
| Compound Name | methyl 3-[5-methyl-3-(2-methylpropyl)cyclohexa-1,3-dien-1-yl]propanoate |
| PubChem CID | 138725199 |
| Molecular Formula | C15H24O2 |
| Molecular Weight | 236.35 g/mol |
| Exact Mass | 236.18 |
| IUPAC Name | methyl 3-[5-methyl-3-(2-methylpropyl)cyclohexa-1,3-dien-1-yl]propanoate |
| SMILES | COC(=O)CCC1=CC(CC(C)C)=CC(C)C1 |
| InChI | InChI=1S/C15H24O2/c1-11(2)7-14-9-12(3)8-13(10-14)5-6-15(16)17-4/h9-12H,5-8H2,1-4H3 |
| InChIKey | FAWWFZZHQVFZSW-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.35 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze methyl 3-[5-methyl-3-(2-methylpropyl)cyclohexa-1,3-dien-1-yl]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-[5-methyl-3-(2-methylpropyl)cyclohexa-1,3-dien-1-yl]propanoate?
The IUPAC name of methyl 3-[5-methyl-3-(2-methylpropyl)cyclohexa-1,3-dien-1-yl]propanoate (CID 138725199) is methyl 3-[5-methyl-3-(2-methylpropyl)cyclohexa-1,3-dien-1-yl]propanoate.
What is the SMILES notation for methyl 3-[5-methyl-3-(2-methylpropyl)cyclohexa-1,3-dien-1-yl]propanoate?
The canonical SMILES for methyl 3-[5-methyl-3-(2-methylpropyl)cyclohexa-1,3-dien-1-yl]propanoate is COC(=O)CCC1=CC(CC(C)C)=CC(C)C1.
What is the InChIKey of methyl 3-[5-methyl-3-(2-methylpropyl)cyclohexa-1,3-dien-1-yl]propanoate?
The InChIKey is FAWWFZZHQVFZSW-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24O2/c1-11(2)7-14-9-12(3)8-13(10-14)5-6-15(16)17-4/h9-12H,5-8H2,1-4H3.
What are the key properties of methyl 3-[5-methyl-3-(2-methylpropyl)cyclohexa-1,3-dien-1-yl]propanoate?
methyl 3-[5-methyl-3-(2-methylpropyl)cyclohexa-1,3-dien-1-yl]propanoate has a molecular weight of 236.35 g/mol, XLogP of 3.88, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-[5-methyl-3-(2-methylpropyl)cyclohexa-1,3-dien-1-yl]propanoate is sourced from PubChem (CID 138725199), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).