C27H34N6O3S — CID 138725220
4-[4-[2-(8-methoxy-[1,2,4]triazolo[1,5-a]pyridin-6-yl)-3-propan-2-yl-1H-pyrrolo[3,2-b]pyridin-5-yl]cyclohexyl]-1,4-thiazinane 1,1-dioxide (PubChem CID 138725220) has the molecular formula C27H34N6O3S and a molecular weight of 522.68 g/mol. Its IUPAC name is 4-[4-[2-(8-methoxy-[1,2,4]triazolo[1,5-a]pyridin-6-yl)-3-propan-2-yl-1H-pyrrolo[3,2-b]pyridin-5-yl]cyclohexyl]-1,4-thiazinane 1,1-dioxide.
| Compound Name | 4-[4-[2-(8-methoxy-[1,2,4]triazolo[1,5-a]pyridin-6-yl)-3-propan-2-yl-1H-pyrrolo[3,2-b]pyridin-5-yl]cyclohexyl]-1,4-thiazinane 1,1-dioxide |
|---|---|
| PubChem CID | 138725220 |
| Molecular Formula | C27H34N6O3S |
| Molecular Weight | 522.68 g/mol |
| Exact Mass | 522.24 |
| IUPAC Name | 4-[4-[2-(8-methoxy-[1,2,4]triazolo[1,5-a]pyridin-6-yl)-3-propan-2-yl-1H-pyrrolo[3,2-b]pyridin-5-yl]cyclohexyl]-1,4-thiazinane 1,1-dioxide |
| SMILES | COc1cc(-c2[nH]c3ccc(C4CCC(N5CCS(=O)(=O)CC5)CC4)nc3c2C(C)C)cn2ncnc12 |
| InChI | InChI=1S/C27H34N6O3S/c1-17(2)24-25(19-14-23(36-3)27-28-16-29-33(27)15-19)31-22-9-8-21(30-26(22)24)18-4-6-20(7-5-18)32-10-12-37(34,35)13-11-32/h8-9,14-18,20,31H,4-7,10-13H2,1-3H3 |
| InChIKey | BOERHUSQTWJESP-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 105.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.68 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |