C18H19FN2O2 — CID 138725230
(11bR)-9-fluoro-7-(1-methoxyethenyl)-11b-methyl-2,3,5,11-tetrahydro-1H-indolizino[8,7-b]indol-6-one (PubChem CID 138725230) has the molecular formula C18H19FN2O2 and a molecular weight of 314.36 g/mol. Its IUPAC name is (11bR)-9-fluoro-7-(1-methoxyethenyl)-11b-methyl-2,3,5,11-tetrahydro-1H-indolizino[8,7-b]indol-6-one.
| Compound Name | (11bR)-9-fluoro-7-(1-methoxyethenyl)-11b-methyl-2,3,5,11-tetrahydro-1H-indolizino[8,7-b]indol-6-one |
|---|---|
| PubChem CID | 138725230 |
| Molecular Formula | C18H19FN2O2 |
| Molecular Weight | 314.36 g/mol |
| Exact Mass | 314.14 |
| IUPAC Name | (11bR)-9-fluoro-7-(1-methoxyethenyl)-11b-methyl-2,3,5,11-tetrahydro-1H-indolizino[8,7-b]indol-6-one |
| SMILES | C=C(OC)c1cc(F)cc2[nH]c3c(c12)C(=O)CN1CCC[C@]31C |
| InChI | InChI=1S/C18H19FN2O2/c1-10(23-3)12-7-11(19)8-13-15(12)16-14(22)9-21-6-4-5-18(21,2)17(16)20-13/h7-8,20H,1,4-6,9H2,2-3H3/t18-/m1/s1 |
| InChIKey | KFEBXWMZXUQCEZ-GOSISDBHSA-N |
| XLogP | 3.43 |
| TPSA | 45.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.36 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|