About 3-fluorohexyl formate
3-fluorohexyl formate (PubChem CID 138725705) has the molecular formula C7H13FO2
and a molecular weight of 148.18 g/mol. Its IUPAC name is 3-fluorohexyl formate.
Molecular Properties
| Compound Name | 3-fluorohexyl formate |
| PubChem CID | 138725705 |
| Molecular Formula | C7H13FO2 |
| Molecular Weight | 148.18 g/mol |
| Exact Mass | 148.09 |
| IUPAC Name | 3-fluorohexyl formate |
| SMILES | CCCC(F)CCOC=O |
| InChI | InChI=1S/C7H13FO2/c1-2-3-7(8)4-5-10-6-9/h6-7H,2-5H2,1H3 |
| InChIKey | FZZGFMPVHQZHQS-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.18 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-fluorohexyl formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-fluorohexyl formate?
The IUPAC name of 3-fluorohexyl formate (CID 138725705) is 3-fluorohexyl formate.
What is the SMILES notation for 3-fluorohexyl formate?
The canonical SMILES for 3-fluorohexyl formate is CCCC(F)CCOC=O.
What is the InChIKey of 3-fluorohexyl formate?
The InChIKey is FZZGFMPVHQZHQS-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13FO2/c1-2-3-7(8)4-5-10-6-9/h6-7H,2-5H2,1H3.
What are the key properties of 3-fluorohexyl formate?
3-fluorohexyl formate has a molecular weight of 148.18 g/mol, XLogP of 1.69, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-fluorohexyl formate is sourced from PubChem (CID 138725705), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).