C28H35N7O — CID 138725726
7,8-dimethyl-6-[5-[(1R,4R)-5-(oxan-4-yl)-2,5-diazabicyclo[2.2.1]heptan-2-yl]-3-propan-2-yl-1H-pyrrolo[3,2-b]pyridin-2-yl]-[1,2,4]triazolo[1,5-a]pyridine (PubChem CID 138725726) has the molecular formula C28H35N7O and a molecular weight of 485.64 g/mol. Its IUPAC name is 7,8-dimethyl-6-[5-[(1R,4R)-5-(oxan-4-yl)-2,5-diazabicyclo[2.2.1]heptan-2-yl]-3-propan-2-yl-1H-pyrrolo[3,2-b]pyridin-2-yl]-[1,2,4]triazolo[1,5-a]pyridine.
| Compound Name | 7,8-dimethyl-6-[5-[(1R,4R)-5-(oxan-4-yl)-2,5-diazabicyclo[2.2.1]heptan-2-yl]-3-propan-2-yl-1H-pyrrolo[3,2-b]pyridin-2-yl]-[1,2,4]triazolo[1,5-a]pyridine |
|---|---|
| PubChem CID | 138725726 |
| Molecular Formula | C28H35N7O |
| Molecular Weight | 485.64 g/mol |
| Exact Mass | 485.29 |
| IUPAC Name | 7,8-dimethyl-6-[5-[(1R,4R)-5-(oxan-4-yl)-2,5-diazabicyclo[2.2.1]heptan-2-yl]-3-propan-2-yl-1H-pyrrolo[3,2-b]pyridin-2-yl]-[1,2,4]triazolo[1,5-a]pyridine |
| SMILES | Cc1c(-c2[nH]c3ccc(N4C[C@H]5C[C@@H]4CN5C4CCOCC4)nc3c2C(C)C)cn2ncnc2c1C |
| InChI | InChI=1S/C28H35N7O/c1-16(2)25-26(22-14-35-28(29-15-30-35)18(4)17(22)3)31-23-5-6-24(32-27(23)25)34-13-20-11-21(34)12-33(20)19-7-9-36-10-8-19/h5-6,14-16,19-21,31H,7-13H2,1-4H3/t20-,21-/m1/s1 |
| InChIKey | MXINYDAFIURRKQ-NHCUHLMSSA-N |
| XLogP | 4.45 |
| TPSA | 74.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.64 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |