About 5-chloro-2-[(2,4-difluoro-3-methylphenoxy)methyl]-1,3-benzothiazole
5-chloro-2-[(2,4-difluoro-3-methylphenoxy)methyl]-1,3-benzothiazole (PubChem CID 138725747) has the molecular formula C15H10ClF2NOS
and a molecular weight of 325.77 g/mol. Its IUPAC name is 5-chloro-2-[(2,4-difluoro-3-methylphenoxy)methyl]-1,3-benzothiazole.
Molecular Properties
| Compound Name | 5-chloro-2-[(2,4-difluoro-3-methylphenoxy)methyl]-1,3-benzothiazole |
| PubChem CID | 138725747 |
| Molecular Formula | C15H10ClF2NOS |
| Molecular Weight | 325.77 g/mol |
| Exact Mass | 325.01 |
| IUPAC Name | 5-chloro-2-[(2,4-difluoro-3-methylphenoxy)methyl]-1,3-benzothiazole |
| SMILES | Cc1c(F)ccc(OCc2nc3cc(Cl)ccc3s2)c1F |
| InChI | InChI=1S/C15H10ClF2NOS/c1-8-10(17)3-4-12(15(8)18)20-7-14-19-11-6-9(16)2-5-13(11)21-14/h2-6H,7H2,1H3 |
| InChIKey | VKTIAEDRKUJKGX-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 325.77 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-chloro-2-[(2,4-difluoro-3-methylphenoxy)methyl]-1,3-benzothiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-2-[(2,4-difluoro-3-methylphenoxy)methyl]-1,3-benzothiazole?
The IUPAC name of 5-chloro-2-[(2,4-difluoro-3-methylphenoxy)methyl]-1,3-benzothiazole (CID 138725747) is 5-chloro-2-[(2,4-difluoro-3-methylphenoxy)methyl]-1,3-benzothiazole.
What is the SMILES notation for 5-chloro-2-[(2,4-difluoro-3-methylphenoxy)methyl]-1,3-benzothiazole?
The canonical SMILES for 5-chloro-2-[(2,4-difluoro-3-methylphenoxy)methyl]-1,3-benzothiazole is Cc1c(F)ccc(OCc2nc3cc(Cl)ccc3s2)c1F.
What is the InChIKey of 5-chloro-2-[(2,4-difluoro-3-methylphenoxy)methyl]-1,3-benzothiazole?
The InChIKey is VKTIAEDRKUJKGX-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H10ClF2NOS/c1-8-10(17)3-4-12(15(8)18)20-7-14-19-11-6-9(16)2-5-13(11)21-14/h2-6H,7H2,1H3.
What are the key properties of 5-chloro-2-[(2,4-difluoro-3-methylphenoxy)methyl]-1,3-benzothiazole?
5-chloro-2-[(2,4-difluoro-3-methylphenoxy)methyl]-1,3-benzothiazole has a molecular weight of 325.77 g/mol, XLogP of 5.12, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-2-[(2,4-difluoro-3-methylphenoxy)methyl]-1,3-benzothiazole is sourced from PubChem (CID 138725747), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).