About N-cyclopentyl-1,3-dimethylimidazol-1-ium-2-carboximidate
N-cyclopentyl-1,3-dimethylimidazol-1-ium-2-carboximidate (PubChem CID 138726009) has the molecular formula C11H17N3O
and a molecular weight of 207.28 g/mol. Its IUPAC name is N-cyclopentyl-1,3-dimethylimidazol-1-ium-2-carboximidate.
Molecular Properties
| Compound Name | N-cyclopentyl-1,3-dimethylimidazol-1-ium-2-carboximidate |
| PubChem CID | 138726009 |
| Molecular Formula | C11H17N3O |
| Molecular Weight | 207.28 g/mol |
| Exact Mass | 207.14 |
| IUPAC Name | N-cyclopentyl-1,3-dimethylimidazol-1-ium-2-carboximidate |
| SMILES | Cn1cc[n+](C)c1/C([O-])=N/C1CCCC1 |
| InChI | InChI=1S/C11H17N3O/c1-13-7-8-14(2)11(13)10(15)12-9-5-3-4-6-9/h7-9H,3-6H2,1-2H3 |
| InChIKey | BYHWVEJWPIRBIW-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 44.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.28 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze N-cyclopentyl-1,3-dimethylimidazol-1-ium-2-carboximidate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclopentyl-1,3-dimethylimidazol-1-ium-2-carboximidate?
The IUPAC name of N-cyclopentyl-1,3-dimethylimidazol-1-ium-2-carboximidate (CID 138726009) is N-cyclopentyl-1,3-dimethylimidazol-1-ium-2-carboximidate.
What is the SMILES notation for N-cyclopentyl-1,3-dimethylimidazol-1-ium-2-carboximidate?
The canonical SMILES for N-cyclopentyl-1,3-dimethylimidazol-1-ium-2-carboximidate is Cn1cc[n+](C)c1/C([O-])=N/C1CCCC1.
What is the InChIKey of N-cyclopentyl-1,3-dimethylimidazol-1-ium-2-carboximidate?
The InChIKey is BYHWVEJWPIRBIW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17N3O/c1-13-7-8-14(2)11(13)10(15)12-9-5-3-4-6-9/h7-9H,3-6H2,1-2H3.
What are the key properties of N-cyclopentyl-1,3-dimethylimidazol-1-ium-2-carboximidate?
N-cyclopentyl-1,3-dimethylimidazol-1-ium-2-carboximidate has a molecular weight of 207.28 g/mol, XLogP of -0.10, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclopentyl-1,3-dimethylimidazol-1-ium-2-carboximidate is sourced from PubChem (CID 138726009), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).