C10H17F2N3S — CID 138726041
9,9-difluoro-6-methyl-3-methylsulfanyl-2,4,5,6,7,8-hexahydro-1H-cycloocta[d]triazole (PubChem CID 138726041) has the molecular formula C10H17F2N3S and a molecular weight of 249.33 g/mol. Its IUPAC name is 9,9-difluoro-6-methyl-3-methylsulfanyl-2,4,5,6,7,8-hexahydro-1H-cycloocta[d]triazole.
| Compound Name | 9,9-difluoro-6-methyl-3-methylsulfanyl-2,4,5,6,7,8-hexahydro-1H-cycloocta[d]triazole |
|---|---|
| PubChem CID | 138726041 |
| Molecular Formula | C10H17F2N3S |
| Molecular Weight | 249.33 g/mol |
| Exact Mass | 249.11 |
| IUPAC Name | 9,9-difluoro-6-methyl-3-methylsulfanyl-2,4,5,6,7,8-hexahydro-1H-cycloocta[d]triazole |
| SMILES | CSN1NNC2=C1CCC(C)CCC2(F)F |
| InChI | InChI=1S/C10H17F2N3S/c1-7-3-4-8-9(10(11,12)6-5-7)13-14-15(8)16-2/h7,13-14H,3-6H2,1-2H3 |
| InChIKey | OPNQOQNGBLQKFT-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.33 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|