C11H17NO2 — CID 138726100
2-ethyl-3-hydroxy-4-methyl-3a,4,7,7a-tetrahydro-3H-isoindol-1-one (PubChem CID 138726100) has the molecular formula C11H17NO2 and a molecular weight of 195.26 g/mol. Its IUPAC name is 2-ethyl-3-hydroxy-4-methyl-3a,4,7,7a-tetrahydro-3H-isoindol-1-one.
| Compound Name | 2-ethyl-3-hydroxy-4-methyl-3a,4,7,7a-tetrahydro-3H-isoindol-1-one |
|---|---|
| PubChem CID | 138726100 |
| Molecular Formula | C11H17NO2 |
| Molecular Weight | 195.26 g/mol |
| Exact Mass | 195.13 |
| IUPAC Name | 2-ethyl-3-hydroxy-4-methyl-3a,4,7,7a-tetrahydro-3H-isoindol-1-one |
| SMILES | CCN1C(=O)C2CC=CC(C)C2C1O |
| InChI | InChI=1S/C11H17NO2/c1-3-12-10(13)8-6-4-5-7(2)9(8)11(12)14/h4-5,7-9,11,14H,3,6H2,1-2H3 |
| InChIKey | PEBPGQCDDGELBH-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.26 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|