C20H30O3 — CID 138726218
5-[(E)-2,6,7,7-tetramethyloct-5-en-2-yl]-3a,4,7,7a-tetrahydro-2-benzofuran-1,3-dione (PubChem CID 138726218) has the molecular formula C20H30O3 and a molecular weight of 318.46 g/mol. Its IUPAC name is 5-[(E)-2,6,7,7-tetramethyloct-5-en-2-yl]-3a,4,7,7a-tetrahydro-2-benzofuran-1,3-dione.
| Compound Name | 5-[(E)-2,6,7,7-tetramethyloct-5-en-2-yl]-3a,4,7,7a-tetrahydro-2-benzofuran-1,3-dione |
|---|---|
| PubChem CID | 138726218 |
| Molecular Formula | C20H30O3 |
| Molecular Weight | 318.46 g/mol |
| Exact Mass | 318.22 |
| IUPAC Name | 5-[(E)-2,6,7,7-tetramethyloct-5-en-2-yl]-3a,4,7,7a-tetrahydro-2-benzofuran-1,3-dione |
| SMILES | C/C(=C\CCC(C)(C)C1=CCC2C(=O)OC(=O)C2C1)C(C)(C)C |
| InChI | InChI=1S/C20H30O3/c1-13(19(2,3)4)8-7-11-20(5,6)14-9-10-15-16(12-14)18(22)23-17(15)21/h8-9,15-16H,7,10-12H2,1-6H3/b13-8+ |
| InChIKey | BGWFGDUHWZOWRW-MDWZMJQESA-N |
| XLogP | 4.82 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.46 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|