C26H48O6 — CID 138726324
1-[[6-[(1-hydroxy-2-methoxyethoxy)methyl]-4-[(E)-2,6,7,7-tetramethyloct-5-en-2-yl]cyclohex-3-en-1-yl]methoxy]-2-methoxyethanol (PubChem CID 138726324) has the molecular formula C26H48O6 and a molecular weight of 456.66 g/mol. Its IUPAC name is 1-[[6-[(1-hydroxy-2-methoxyethoxy)methyl]-4-[(E)-2,6,7,7-tetramethyloct-5-en-2-yl]cyclohex-3-en-1-yl]methoxy]-2-methoxyethanol.
| Compound Name | 1-[[6-[(1-hydroxy-2-methoxyethoxy)methyl]-4-[(E)-2,6,7,7-tetramethyloct-5-en-2-yl]cyclohex-3-en-1-yl]methoxy]-2-methoxyethanol |
|---|---|
| PubChem CID | 138726324 |
| Molecular Formula | C26H48O6 |
| Molecular Weight | 456.66 g/mol |
| Exact Mass | 456.35 |
| IUPAC Name | 1-[[6-[(1-hydroxy-2-methoxyethoxy)methyl]-4-[(E)-2,6,7,7-tetramethyloct-5-en-2-yl]cyclohex-3-en-1-yl]methoxy]-2-methoxyethanol |
| SMILES | COCC(O)OCC1CC=C(C(C)(C)CC/C=C(\C)C(C)(C)C)CC1COC(O)COC |
| InChI | InChI=1S/C26H48O6/c1-19(25(2,3)4)10-9-13-26(5,6)22-12-11-20(15-31-23(27)17-29-7)21(14-22)16-32-24(28)18-30-8/h10,12,20-21,23-24,27-28H,9,11,13-18H2,1-8H3/b19-10+ |
| InChIKey | UNDWJQWKWVIUGO-VXLYETTFSA-N |
| XLogP | 4.70 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.66 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|