C17H23N5OS — CID 138726325
8-[4-amino-3-[amino(methyl)amino]phenyl]-N-ethylsulfanyl-3,4-dihydro-1H-pyrano[4,3-c]pyridin-4-amine (PubChem CID 138726325) has the molecular formula C17H23N5OS and a molecular weight of 345.47 g/mol. Its IUPAC name is 8-[4-amino-3-[amino(methyl)amino]phenyl]-N-ethylsulfanyl-3,4-dihydro-1H-pyrano[4,3-c]pyridin-4-amine.
| Compound Name | 8-[4-amino-3-[amino(methyl)amino]phenyl]-N-ethylsulfanyl-3,4-dihydro-1H-pyrano[4,3-c]pyridin-4-amine |
|---|---|
| PubChem CID | 138726325 |
| Molecular Formula | C17H23N5OS |
| Molecular Weight | 345.47 g/mol |
| Exact Mass | 345.16 |
| IUPAC Name | 8-[4-amino-3-[amino(methyl)amino]phenyl]-N-ethylsulfanyl-3,4-dihydro-1H-pyrano[4,3-c]pyridin-4-amine |
| SMILES | CCSNC1COCc2c(-c3ccc(N)c(N(C)N)c3)cncc21 |
| InChI | InChI=1S/C17H23N5OS/c1-3-24-21-16-10-23-9-14-12(7-20-8-13(14)16)11-4-5-15(18)17(6-11)22(2)19/h4-8,16,21H,3,9-10,18-19H2,1-2H3 |
| InChIKey | WWJVHNUUCBEMBV-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 89.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.47 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|