C12H21N — CID 138726585
(2E,3E,5R)-1-ethyl-2,3-di(ethylidene)-5-methylpiperidine (PubChem CID 138726585) has the molecular formula C12H21N and a molecular weight of 179.31 g/mol. Its IUPAC name is (2E,3E,5R)-1-ethyl-2,3-di(ethylidene)-5-methylpiperidine.
| Compound Name | (2E,3E,5R)-1-ethyl-2,3-di(ethylidene)-5-methylpiperidine |
|---|---|
| PubChem CID | 138726585 |
| Molecular Formula | C12H21N |
| Molecular Weight | 179.31 g/mol |
| Exact Mass | 179.17 |
| IUPAC Name | (2E,3E,5R)-1-ethyl-2,3-di(ethylidene)-5-methylpiperidine |
| SMILES | C/C=C1\C[C@@H](C)CN(CC)\C1=C\C |
| InChI | InChI=1S/C12H21N/c1-5-11-8-10(4)9-13(7-3)12(11)6-2/h5-6,10H,7-9H2,1-4H3/b11-5+,12-6+/t10-/m1/s1 |
| InChIKey | OBNTVNCZVQZMMF-DVYUKCRISA-N |
| XLogP | 3.20 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.31 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |