C30H32F3N7O3 — CID 138726912
N-[1-(4-tert-butylphenyl)-3-(3,3-dimethyl-2-oxopyrrolidin-1-yl)pyrazol-4-yl]-2-[2-(2,2,2-trifluoroethylamino)-4-pyridinyl]-1,3-oxazole-4-carboxamide (PubChem CID 138726912) has the molecular formula C30H32F3N7O3 and a molecular weight of 595.63 g/mol. Its IUPAC name is N-[1-(4-tert-butylphenyl)-3-(3,3-dimethyl-2-oxopyrrolidin-1-yl)pyrazol-4-yl]-2-[2-(2,2,2-trifluoroethylamino)-4-pyridinyl]-1,3-oxazole-4-carboxamide.
| Compound Name | N-[1-(4-tert-butylphenyl)-3-(3,3-dimethyl-2-oxopyrrolidin-1-yl)pyrazol-4-yl]-2-[2-(2,2,2-trifluoroethylamino)-4-pyridinyl]-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 138726912 |
| Molecular Formula | C30H32F3N7O3 |
| Molecular Weight | 595.63 g/mol |
| Exact Mass | 595.25 |
| IUPAC Name | N-[1-(4-tert-butylphenyl)-3-(3,3-dimethyl-2-oxopyrrolidin-1-yl)pyrazol-4-yl]-2-[2-(2,2,2-trifluoroethylamino)-4-pyridinyl]-1,3-oxazole-4-carboxamide |
| SMILES | CC1(C)CCN(c2nn(-c3ccc(C(C)(C)C)cc3)cc2NC(=O)c2coc(-c3ccnc(NCC(F)(F)F)c3)n2)C1=O |
| InChI | InChI=1S/C30H32F3N7O3/c1-28(2,3)19-6-8-20(9-7-19)40-15-21(24(38-40)39-13-11-29(4,5)27(39)42)36-25(41)22-16-43-26(37-22)18-10-12-34-23(14-18)35-17-30(31,32)33/h6-10,12,14-16H,11,13,17H2,1-5H3,(H,34,35)(H,36,41) |
| InChIKey | CHGUFWQKICGWPD-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 118.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.63 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |