About N'-(disulfanylmethyl)-N,N'-dimethyl-N-(2-methylpropyl)propane-1,3-diamine
N'-(disulfanylmethyl)-N,N'-dimethyl-N-(2-methylpropyl)propane-1,3-diamine (PubChem CID 138727017) has the molecular formula C10H24N2S2
and a molecular weight of 236.45 g/mol. Its IUPAC name is N'-(disulfanylmethyl)-N,N'-dimethyl-N-(2-methylpropyl)propane-1,3-diamine.
Molecular Properties
| Compound Name | N'-(disulfanylmethyl)-N,N'-dimethyl-N-(2-methylpropyl)propane-1,3-diamine |
| PubChem CID | 138727017 |
| Molecular Formula | C10H24N2S2 |
| Molecular Weight | 236.45 g/mol |
| Exact Mass | 236.14 |
| IUPAC Name | N'-(disulfanylmethyl)-N,N'-dimethyl-N-(2-methylpropyl)propane-1,3-diamine |
| SMILES | CC(C)CN(C)CCCN(C)CSS |
| InChI | InChI=1S/C10H24N2S2/c1-10(2)8-11(3)6-5-7-12(4)9-14-13/h10,13H,5-9H2,1-4H3 |
| InChIKey | DKTMJXRTDTVRTC-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 6.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.45 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze N'-(disulfanylmethyl)-N,N'-dimethyl-N-(2-methylpropyl)propane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(disulfanylmethyl)-N,N'-dimethyl-N-(2-methylpropyl)propane-1,3-diamine?
The IUPAC name of N'-(disulfanylmethyl)-N,N'-dimethyl-N-(2-methylpropyl)propane-1,3-diamine (CID 138727017) is N'-(disulfanylmethyl)-N,N'-dimethyl-N-(2-methylpropyl)propane-1,3-diamine.
What is the SMILES notation for N'-(disulfanylmethyl)-N,N'-dimethyl-N-(2-methylpropyl)propane-1,3-diamine?
The canonical SMILES for N'-(disulfanylmethyl)-N,N'-dimethyl-N-(2-methylpropyl)propane-1,3-diamine is CC(C)CN(C)CCCN(C)CSS.
What is the InChIKey of N'-(disulfanylmethyl)-N,N'-dimethyl-N-(2-methylpropyl)propane-1,3-diamine?
The InChIKey is DKTMJXRTDTVRTC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H24N2S2/c1-10(2)8-11(3)6-5-7-12(4)9-14-13/h10,13H,5-9H2,1-4H3.
What are the key properties of N'-(disulfanylmethyl)-N,N'-dimethyl-N-(2-methylpropyl)propane-1,3-diamine?
N'-(disulfanylmethyl)-N,N'-dimethyl-N-(2-methylpropyl)propane-1,3-diamine has a molecular weight of 236.45 g/mol, XLogP of 2.43, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(disulfanylmethyl)-N,N'-dimethyl-N-(2-methylpropyl)propane-1,3-diamine is sourced from PubChem (CID 138727017), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).