C11H20N2O4 — CID 138727871
N-[(6S,7R,8R)-1,7,8-trihydroxy-1,2,3,5,6,7,8,8a-octahydroindolizin-6-yl]propanamide (PubChem CID 138727871) has the molecular formula C11H20N2O4 and a molecular weight of 244.29 g/mol. Its IUPAC name is N-[(6S,7R,8R)-1,7,8-trihydroxy-1,2,3,5,6,7,8,8a-octahydroindolizin-6-yl]propanamide.
| Compound Name | N-[(6S,7R,8R)-1,7,8-trihydroxy-1,2,3,5,6,7,8,8a-octahydroindolizin-6-yl]propanamide |
|---|---|
| PubChem CID | 138727871 |
| Molecular Formula | C11H20N2O4 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.14 |
| IUPAC Name | N-[(6S,7R,8R)-1,7,8-trihydroxy-1,2,3,5,6,7,8,8a-octahydroindolizin-6-yl]propanamide |
| SMILES | CCC(=O)N[C@H]1CN2CCC(O)C2[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C11H20N2O4/c1-2-8(15)12-6-5-13-4-3-7(14)9(13)11(17)10(6)16/h6-7,9-11,14,16-17H,2-5H2,1H3,(H,12,15)/t6-,7?,9?,10+,11+/m0/s1 |
| InChIKey | AMFGENNVNAOLCL-AQKWVRGGSA-N |
| XLogP | -1.95 |
| TPSA | 93.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | -1.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |