C20H25NO6 — CID 138728228
[(1S,6S,7R,8R)-1,8-diacetyloxy-6-methyl-1,2,3,5,6,7,8,8a-octahydroindolizin-7-yl] benzoate (PubChem CID 138728228) has the molecular formula C20H25NO6 and a molecular weight of 375.42 g/mol. Its IUPAC name is [(1S,6S,7R,8R)-1,8-diacetyloxy-6-methyl-1,2,3,5,6,7,8,8a-octahydroindolizin-7-yl] benzoate.
| Compound Name | [(1S,6S,7R,8R)-1,8-diacetyloxy-6-methyl-1,2,3,5,6,7,8,8a-octahydroindolizin-7-yl] benzoate |
|---|---|
| PubChem CID | 138728228 |
| Molecular Formula | C20H25NO6 |
| Molecular Weight | 375.42 g/mol |
| Exact Mass | 375.17 |
| IUPAC Name | [(1S,6S,7R,8R)-1,8-diacetyloxy-6-methyl-1,2,3,5,6,7,8,8a-octahydroindolizin-7-yl] benzoate |
| SMILES | CC(=O)O[C@H]1CCN2CC(C)[C@@H](OC(=O)c3ccccc3)[C@H](OC(C)=O)C12 |
| InChI | InChI=1S/C20H25NO6/c1-12-11-21-10-9-16(25-13(2)22)17(21)19(26-14(3)23)18(12)27-20(24)15-7-5-4-6-8-15/h4-8,12,16-19H,9-11H2,1-3H3/t12?,16-,17?,18+,19+/m0/s1 |
| InChIKey | UEGZWUAARTYEHF-GAORWENJSA-N |
| XLogP | 1.80 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.42 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|