C28H33N7O — CID 138728269
3-[(2E,4Z)-5-(methylideneamino)hexa-2,4-dien-3-yl]-6-[(3R)-1-[(6-methyl-3-pyridinyl)methyl]piperidin-3-yl]-5,8-dihydro-1H-pyrazolo[4,5-g]quinazolin-7-one (PubChem CID 138728269) has the molecular formula C28H33N7O and a molecular weight of 483.62 g/mol. Its IUPAC name is 3-[(2E,4Z)-5-(methylideneamino)hexa-2,4-dien-3-yl]-6-[(3R)-1-[(6-methyl-3-pyridinyl)methyl]piperidin-3-yl]-5,8-dihydro-1H-pyrazolo[4,5-g]quinazolin-7-one.
| Compound Name | 3-[(2E,4Z)-5-(methylideneamino)hexa-2,4-dien-3-yl]-6-[(3R)-1-[(6-methyl-3-pyridinyl)methyl]piperidin-3-yl]-5,8-dihydro-1H-pyrazolo[4,5-g]quinazolin-7-one |
|---|---|
| PubChem CID | 138728269 |
| Molecular Formula | C28H33N7O |
| Molecular Weight | 483.62 g/mol |
| Exact Mass | 483.27 |
| IUPAC Name | 3-[(2E,4Z)-5-(methylideneamino)hexa-2,4-dien-3-yl]-6-[(3R)-1-[(6-methyl-3-pyridinyl)methyl]piperidin-3-yl]-5,8-dihydro-1H-pyrazolo[4,5-g]quinazolin-7-one |
| SMILES | C=N/C(C)=C\C(=C/C)c1n[nH]c2cc3c(cc12)CN([C@@H]1CCCN(Cc2ccc(C)nc2)C1)C(=O)N3 |
| InChI | InChI=1S/C28H33N7O/c1-5-21(11-19(3)29-4)27-24-12-22-16-35(28(36)31-25(22)13-26(24)32-33-27)23-7-6-10-34(17-23)15-20-9-8-18(2)30-14-20/h5,8-9,11-14,23H,4,6-7,10,15-17H2,1-3H3,(H,31,36)(H,32,33)/b19-11-,21-5+/t23-/m1/s1 |
| InChIKey | ISXPMKXWZAQXFN-DINBGVEYSA-N |
| XLogP | 5.29 |
| TPSA | 89.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.62 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|