C22H22F6N6O — CID 138729195
8-methyl-5-(2,2,2-trifluoroethoxy)-N-[(1S,5R)-3-[2-(trifluoromethyl)-4-pyridinyl]-3-azabicyclo[3.2.1]octan-8-yl]-[1,2,4]triazolo[1,5-a]pyridin-2-amine (PubChem CID 138729195) has the molecular formula C22H22F6N6O and a molecular weight of 500.45 g/mol. Its IUPAC name is 8-methyl-5-(2,2,2-trifluoroethoxy)-N-[(1S,5R)-3-[2-(trifluoromethyl)-4-pyridinyl]-3-azabicyclo[3.2.1]octan-8-yl]-[1,2,4]triazolo[1,5-a]pyridin-2-amine.
| Compound Name | 8-methyl-5-(2,2,2-trifluoroethoxy)-N-[(1S,5R)-3-[2-(trifluoromethyl)-4-pyridinyl]-3-azabicyclo[3.2.1]octan-8-yl]-[1,2,4]triazolo[1,5-a]pyridin-2-amine |
|---|---|
| PubChem CID | 138729195 |
| Molecular Formula | C22H22F6N6O |
| Molecular Weight | 500.45 g/mol |
| Exact Mass | 500.18 |
| IUPAC Name | 8-methyl-5-(2,2,2-trifluoroethoxy)-N-[(1S,5R)-3-[2-(trifluoromethyl)-4-pyridinyl]-3-azabicyclo[3.2.1]octan-8-yl]-[1,2,4]triazolo[1,5-a]pyridin-2-amine |
| SMILES | Cc1ccc(OCC(F)(F)F)n2nc(NC3[C@@H]4CC[C@H]3CN(c3ccnc(C(F)(F)F)c3)C4)nc12 |
| InChI | InChI=1S/C22H22F6N6O/c1-12-2-5-17(35-11-21(23,24)25)34-19(12)31-20(32-34)30-18-13-3-4-14(18)10-33(9-13)15-6-7-29-16(8-15)22(26,27)28/h2,5-8,13-14,18H,3-4,9-11H2,1H3,(H,30,32)/t13-,14+,18? |
| InChIKey | RBLXYIHWINRNPQ-UUVAVEHKSA-N |
| XLogP | 4.72 |
| TPSA | 67.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.45 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |