C50H24F12N6 — CID 138729233
2,5-bis[3,6-bis(trifluoromethyl)carbazol-9-yl]-4-(4,6-diphenyl-1,3,5-triazin-2-yl)benzonitrile (PubChem CID 138729233) has the molecular formula C50H24F12N6 and a molecular weight of 936.76 g/mol. Its IUPAC name is 2,5-bis[3,6-bis(trifluoromethyl)carbazol-9-yl]-4-(4,6-diphenyl-1,3,5-triazin-2-yl)benzonitrile.
| Compound Name | 2,5-bis[3,6-bis(trifluoromethyl)carbazol-9-yl]-4-(4,6-diphenyl-1,3,5-triazin-2-yl)benzonitrile |
|---|---|
| PubChem CID | 138729233 |
| Molecular Formula | C50H24F12N6 |
| Molecular Weight | 936.76 g/mol |
| Exact Mass | 936.19 |
| IUPAC Name | 2,5-bis[3,6-bis(trifluoromethyl)carbazol-9-yl]-4-(4,6-diphenyl-1,3,5-triazin-2-yl)benzonitrile |
| SMILES | N#Cc1cc(-n2c3ccc(C(F)(F)F)cc3c3cc(C(F)(F)F)ccc32)c(-c2nc(-c3ccccc3)nc(-c3ccccc3)n2)cc1-n1c2ccc(C(F)(F)F)cc2c2cc(C(F)(F)F)ccc21 |
| InChI | InChI=1S/C50H24F12N6/c51-47(52,53)29-11-15-38-33(20-29)34-21-30(48(54,55)56)12-16-39(34)67(38)42-24-37(46-65-44(26-7-3-1-4-8-26)64-45(66-46)27-9-5-2-6-10-27)43(19-28(42)25-63)68-40-17-13-31(49(57,58)59)22-35(40)36-23-32(50(60,61)62)14-18-41(36)68/h1-24H |
| InChIKey | YLIIFTAKBDSPHJ-UHFFFAOYSA-N |
| XLogP | 15.01 |
| TPSA | 72.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 936.76 |
| LogP ≤ 5 | 15.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |