C23H28F3N7O — CID 138729415
N-[(1S,5R)-3-(6-methylpyrimidin-4-yl)-3-azabicyclo[3.2.1]octan-8-yl]-8-propan-2-yl-5-(2,2,2-trifluoroethoxy)-[1,2,4]triazolo[1,5-a]pyridin-2-amine (PubChem CID 138729415) has the molecular formula C23H28F3N7O and a molecular weight of 475.52 g/mol. Its IUPAC name is N-[(1S,5R)-3-(6-methylpyrimidin-4-yl)-3-azabicyclo[3.2.1]octan-8-yl]-8-propan-2-yl-5-(2,2,2-trifluoroethoxy)-[1,2,4]triazolo[1,5-a]pyridin-2-amine.
| Compound Name | N-[(1S,5R)-3-(6-methylpyrimidin-4-yl)-3-azabicyclo[3.2.1]octan-8-yl]-8-propan-2-yl-5-(2,2,2-trifluoroethoxy)-[1,2,4]triazolo[1,5-a]pyridin-2-amine |
|---|---|
| PubChem CID | 138729415 |
| Molecular Formula | C23H28F3N7O |
| Molecular Weight | 475.52 g/mol |
| Exact Mass | 475.23 |
| IUPAC Name | N-[(1S,5R)-3-(6-methylpyrimidin-4-yl)-3-azabicyclo[3.2.1]octan-8-yl]-8-propan-2-yl-5-(2,2,2-trifluoroethoxy)-[1,2,4]triazolo[1,5-a]pyridin-2-amine |
| SMILES | Cc1cc(N2C[C@H]3CC[C@@H](C2)C3Nc2nc3c(C(C)C)ccc(OCC(F)(F)F)n3n2)ncn1 |
| InChI | InChI=1S/C23H28F3N7O/c1-13(2)17-6-7-19(34-11-23(24,25)26)33-21(17)30-22(31-33)29-20-15-4-5-16(20)10-32(9-15)18-8-14(3)27-12-28-18/h6-8,12-13,15-16,20H,4-5,9-11H2,1-3H3,(H,29,31)/t15-,16+,20? |
| InChIKey | MEMLZDLENRRYDO-NYTJIUQPSA-N |
| XLogP | 4.22 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.52 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |