C18H21N5O4 — CID 138730234
N-(2,3-dioxopiperidin-4-yl)-3-methyl-2-[(5-pyridin-4-yl-1,3-oxazol-2-yl)amino]butanamide (PubChem CID 138730234) has the molecular formula C18H21N5O4 and a molecular weight of 371.40 g/mol. Its IUPAC name is N-(2,3-dioxopiperidin-4-yl)-3-methyl-2-[(5-pyridin-4-yl-1,3-oxazol-2-yl)amino]butanamide.
| Compound Name | N-(2,3-dioxopiperidin-4-yl)-3-methyl-2-[(5-pyridin-4-yl-1,3-oxazol-2-yl)amino]butanamide |
|---|---|
| PubChem CID | 138730234 |
| Molecular Formula | C18H21N5O4 |
| Molecular Weight | 371.40 g/mol |
| Exact Mass | 371.16 |
| IUPAC Name | N-(2,3-dioxopiperidin-4-yl)-3-methyl-2-[(5-pyridin-4-yl-1,3-oxazol-2-yl)amino]butanamide |
| SMILES | CC(C)C(Nc1ncc(-c2ccncc2)o1)C(=O)NC1CCNC(=O)C1=O |
| InChI | InChI=1S/C18H21N5O4/c1-10(2)14(16(25)22-12-5-8-20-17(26)15(12)24)23-18-21-9-13(27-18)11-3-6-19-7-4-11/h3-4,6-7,9-10,12,14H,5,8H2,1-2H3,(H,20,26)(H,21,23)(H,22,25) |
| InChIKey | DHBADORASNFKEU-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 126.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.40 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|