C10H12F5NO4 — CID 138731972
(E)-3-(5,5-difluoropiperidin-3-yl)prop-2-enoic acid;2,2,2-trifluoroacetic acid (PubChem CID 138731972) has the molecular formula C10H12F5NO4 and a molecular weight of 305.20 g/mol. Its IUPAC name is (E)-3-(5,5-difluoropiperidin-3-yl)prop-2-enoic acid;2,2,2-trifluoroacetic acid.
| Compound Name | (E)-3-(5,5-difluoropiperidin-3-yl)prop-2-enoic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 138731972 |
| Molecular Formula | C10H12F5NO4 |
| Molecular Weight | 305.20 g/mol |
| Exact Mass | 305.07 |
| IUPAC Name | (E)-3-(5,5-difluoropiperidin-3-yl)prop-2-enoic acid;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)/C=C/C1CNCC(F)(F)C1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C8H11F2NO2.C2HF3O2/c9-8(10)3-6(4-11-5-8)1-2-7(12)13;3-2(4,5)1(6)7/h1-2,6,11H,3-5H2,(H,12,13);(H,6,7)/b2-1+; |
| InChIKey | GTZCJCBYWXEXMR-TYYBGVCCSA-N |
| XLogP | 1.51 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.20 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|