C13H21NO3 — CID 138732325
6-hydroxy-5,5,8a-trimethyl-3,6,7,8-tetrahydro-1H-isoquinoline-2-carboxylic acid (PubChem CID 138732325) has the molecular formula C13H21NO3 and a molecular weight of 239.31 g/mol. Its IUPAC name is 6-hydroxy-5,5,8a-trimethyl-3,6,7,8-tetrahydro-1H-isoquinoline-2-carboxylic acid.
| Compound Name | 6-hydroxy-5,5,8a-trimethyl-3,6,7,8-tetrahydro-1H-isoquinoline-2-carboxylic acid |
|---|---|
| PubChem CID | 138732325 |
| Molecular Formula | C13H21NO3 |
| Molecular Weight | 239.31 g/mol |
| Exact Mass | 239.15 |
| IUPAC Name | 6-hydroxy-5,5,8a-trimethyl-3,6,7,8-tetrahydro-1H-isoquinoline-2-carboxylic acid |
| SMILES | CC12CCC(O)C(C)(C)C1=CCN(C(=O)O)C2 |
| InChI | InChI=1S/C13H21NO3/c1-12(2)9-5-7-14(11(16)17)8-13(9,3)6-4-10(12)15/h5,10,15H,4,6-8H2,1-3H3,(H,16,17) |
| InChIKey | SBHZCWLMBGWRJS-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.31 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|